C15H22BrN3 — CID 110031727
2-[2-(2-bromophenyl)-2-methylpropyl]-1-cyclopropyl-1-methylguanidine (PubChem CID 110031727) has the molecular formula C15H22BrN3 and a molecular weight of 324.27 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-2-methylpropyl]-1-cyclopropyl-1-methylguanidine.
| Compound Name | 2-[2-(2-bromophenyl)-2-methylpropyl]-1-cyclopropyl-1-methylguanidine |
|---|---|
| PubChem CID | 110031727 |
| Molecular Formula | C15H22BrN3 |
| Molecular Weight | 324.27 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[2-(2-bromophenyl)-2-methylpropyl]-1-cyclopropyl-1-methylguanidine |
| SMILES | CN(/C(N)=N/CC(C)(C)c1ccccc1Br)C1CC1 |
| InChI | InChI=1S/C15H22BrN3/c1-15(2,12-6-4-5-7-13(12)16)10-18-14(17)19(3)11-8-9-11/h4-7,11H,8-10H2,1-3H3,(H2,17,18) |
| InChIKey | MVTNMCDOHNMXDP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|