C24H28N2O3S — CID 9457485
[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate (PubChem CID 9457485) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate.
| Compound Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 9457485 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate |
| SMILES | CN(/C(=N/c1ccccc1)SCC(=O)c1ccc2c(c1)OCCO2)C1CCCCC1 |
| InChI | InChI=1S/C24H28N2O3S/c1-26(20-10-6-3-7-11-20)24(25-19-8-4-2-5-9-19)30-17-21(27)18-12-13-22-23(16-18)29-15-14-28-22/h2,4-5,8-9,12-13,16,20H,3,6-7,10-11,14-15,17H2,1H3/b25-24- |
| InChIKey | UZTIUOQHLGHJLI-IZHYLOQSSA-N |
| XLogP | 5.33 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|