C24H31N3OS — CID 9423664
[2-(2-ethylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate (PubChem CID 9423664) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 9423664 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate |
| SMILES | CCc1ccccc1NC(=O)CS/C(=N\c1ccccc1)N(C)C1CCCCC1 |
| InChI | InChI=1S/C24H31N3OS/c1-3-19-12-10-11-17-22(19)26-23(28)18-29-24(25-20-13-6-4-7-14-20)27(2)21-15-8-5-9-16-21/h4,6-7,10-14,17,21H,3,5,8-9,15-16,18H2,1-2H3,(H,26,28)/b25-24- |
| InChIKey | FEZKYVKCVNXCAE-IZHYLOQSSA-N |
| XLogP | 5.87 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|