C23H29N3OS — CID 9456986
[2-(3-methylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate (PubChem CID 9456986) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 9456986 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] N-cyclohexyl-N-methyl-N'-phenylcarbamimidothioate |
| SMILES | Cc1cccc(NC(=O)CS/C(=N\c2ccccc2)N(C)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H29N3OS/c1-18-10-9-13-20(16-18)24-22(27)17-28-23(25-19-11-5-3-6-12-19)26(2)21-14-7-4-8-15-21/h3,5-6,9-13,16,21H,4,7-8,14-15,17H2,1-2H3,(H,24,27)/b25-23- |
| InChIKey | AIMDFLZJMVQFND-BZZOAKBMSA-N |
| XLogP | 5.62 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|