C12H17N3O2S — CID 62361395
1-(1,1-dioxothiolan-3-yl)-1-methyl-2-phenylguanidine (PubChem CID 62361395) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-1-methyl-2-phenylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-1-methyl-2-phenylguanidine |
|---|---|
| PubChem CID | 62361395 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-1-methyl-2-phenylguanidine |
| SMILES | CN(/C(N)=N/c1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17N3O2S/c1-15(11-7-8-18(16,17)9-11)12(13)14-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H2,13,14) |
| InChIKey | BFOIOKHMFFZTIR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|