C9H17N7O2 — CID 176518818
2-carbamimidoyl-1,1-dimethylguanidine;5-methyl-1H-pyrazole-3-carboxylic acid (PubChem CID 176518818) has the molecular formula C9H17N7O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-carbamimidoyl-1,1-dimethylguanidine;5-methyl-1H-pyrazole-3-carboxylic acid.
| Compound Name | 2-carbamimidoyl-1,1-dimethylguanidine;5-methyl-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 176518818 |
| Molecular Formula | C9H17N7O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-carbamimidoyl-1,1-dimethylguanidine;5-methyl-1H-pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)n[nH]1.[H]/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C5H6N2O2.C4H11N5/c1-3-2-4(5(8)9)7-6-3;1-9(2)4(7)8-3(5)6/h2H,1H3,(H,6,7)(H,8,9);1-2H3,(H5,5,6,7,8) |
| InChIKey | YBONKDJKRDTTFY-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 157.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|