C9H12NO3+ — CID 4866773
[2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylazanium (PubChem CID 4866773) has the molecular formula C9H12NO3+ and a molecular weight of 182.20 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 4866773 |
| Molecular Formula | C9H12NO3+ |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-2-oxoethyl]-methylazanium |
| SMILES | C[NH2+]CC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H11NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,10-12H,5H2,1H3/p+1 |
| InChIKey | PZMVOUYYNKPMSI-UHFFFAOYSA-O |
| XLogP | -0.53 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|