C11H15Cl2NO3 — CID 110174063
3-chloropropyl-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium chloride (PubChem CID 110174063) has the molecular formula C11H15Cl2NO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is 3-chloropropyl-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium chloride.
| Compound Name | 3-chloropropyl-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium chloride |
|---|---|
| PubChem CID | 110174063 |
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 3-chloropropyl-[2-(3,4-dihydroxyphenyl)-2-oxoethyl]azanium chloride |
| SMILES | O=C(C[NH2+]CCCCl)c1ccc(O)c(O)c1.[Cl-] |
| InChI | InChI=1S/C11H14ClNO3.ClH/c12-4-1-5-13-7-11(16)8-2-3-9(14)10(15)6-8;/h2-3,6,13-15H,1,4-5,7H2;1H |
| InChIKey | XHZMMUFCOWXJSV-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|