C14H11FO3 — CID 46881771
1-(3,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone (PubChem CID 46881771) has the molecular formula C14H11FO3 and a molecular weight of 246.24 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 46881771 |
| Molecular Formula | C14H11FO3 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H11FO3/c15-11-4-1-9(2-5-11)7-13(17)10-3-6-12(16)14(18)8-10/h1-6,8,16,18H,7H2 |
| InChIKey | KVYRXZWBRHLYIL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|