C14H12FNO3 — CID 135923223
4-[(E)-C-[(4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol (PubChem CID 135923223) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-[(E)-C-[(4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol.
| Compound Name | 4-[(E)-C-[(4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135923223 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-[(E)-C-[(4-fluorophenyl)methyl]-N-hydroxycarbonimidoyl]benzene-1,2-diol |
| SMILES | O/N=C(\Cc1ccc(F)cc1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H12FNO3/c15-11-4-1-9(2-5-11)7-12(16-19)10-3-6-13(17)14(18)8-10/h1-6,8,17-19H,7H2/b16-12+ |
| InChIKey | XMYFKENTHDGWBK-FOWTUZBSSA-N |
| XLogP | 2.66 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|