C15H12F2Zr+2 — CID 87754590
1,3-bis(4-fluorophenyl)propan-2-ylidenezirconium(2+) (PubChem CID 87754590) has the molecular formula C15H12F2Zr+2 and a molecular weight of 321.48 g/mol. Its IUPAC name is 1,3-bis(4-fluorophenyl)propan-2-ylidenezirconium(2+).
| Compound Name | 1,3-bis(4-fluorophenyl)propan-2-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 87754590 |
| Molecular Formula | C15H12F2Zr+2 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 1,3-bis(4-fluorophenyl)propan-2-ylidenezirconium(2+) |
| SMILES | Fc1ccc(CC(=[Zr+2])Cc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H12F2.Zr/c16-14-8-4-12(5-9-14)2-1-3-13-6-10-15(17)11-7-13;/h4-11H,2-3H2;/q;+2 |
| InChIKey | NPQDPPMADBTNLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |