sodium 1-ethyl-4-fluorobenzene

C8H8FNa — CID 174390986

IUPACsodium 1-ethyl-4-fluorobenzene
SMILES[CH2-]Cc1ccc(F)cc1.[Na+]
InChIInChI=1S/C8H8F.Na/c1-2-7-3-5-8(9)6-4-7;/h3-6H,1-2H2;/q-1;+1
InChIKeyZKTDEECCMQAHQX-UHFFFAOYSA-N
MW146.14 g/mol
LogP-0.79
Rot. Bonds1

About sodium 1-ethyl-4-fluorobenzene

sodium 1-ethyl-4-fluorobenzene (PubChem CID 174390986) has the molecular formula C8H8FNa and a molecular weight of 146.14 g/mol. Its IUPAC name is sodium 1-ethyl-4-fluorobenzene.

Molecular Properties

Compound Namesodium 1-ethyl-4-fluorobenzene
PubChem CID174390986
Molecular FormulaC8H8FNa
Molecular Weight146.14 g/mol
Exact Mass146.05
IUPAC Namesodium 1-ethyl-4-fluorobenzene
SMILES[CH2-]Cc1ccc(F)cc1.[Na+]
InChIInChI=1S/C8H8F.Na/c1-2-7-3-5-8(9)6-4-7;/h3-6H,1-2H2;/q-1;+1
InChIKeyZKTDEECCMQAHQX-UHFFFAOYSA-N
XLogP-0.79
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.14
LogP ≤ 5-0.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze sodium 1-ethyl-4-fluorobenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 1-ethyl-4-fluorobenzene?
The IUPAC name of sodium 1-ethyl-4-fluorobenzene (CID 174390986) is sodium 1-ethyl-4-fluorobenzene.
What is the SMILES notation for sodium 1-ethyl-4-fluorobenzene?
The canonical SMILES for sodium 1-ethyl-4-fluorobenzene is [CH2-]Cc1ccc(F)cc1.[Na+].
What is the InChIKey of sodium 1-ethyl-4-fluorobenzene?
The InChIKey is ZKTDEECCMQAHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F.Na/c1-2-7-3-5-8(9)6-4-7;/h3-6H,1-2H2;/q-1;+1.
What are the key properties of sodium 1-ethyl-4-fluorobenzene?
sodium 1-ethyl-4-fluorobenzene has a molecular weight of 146.14 g/mol, XLogP of -0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-ethyl-4-fluorobenzene is sourced from PubChem (CID 174390986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).