About sodium 1-ethyl-4-fluorobenzene
sodium 1-ethyl-4-fluorobenzene (PubChem CID 174390986) has the molecular formula C8H8FNa
and a molecular weight of 146.14 g/mol. Its IUPAC name is sodium 1-ethyl-4-fluorobenzene.
Molecular Properties
| Compound Name | sodium 1-ethyl-4-fluorobenzene |
| PubChem CID | 174390986 |
| Molecular Formula | C8H8FNa |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.05 |
| IUPAC Name | sodium 1-ethyl-4-fluorobenzene |
| SMILES | [CH2-]Cc1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C8H8F.Na/c1-2-7-3-5-8(9)6-4-7;/h3-6H,1-2H2;/q-1;+1 |
| InChIKey | ZKTDEECCMQAHQX-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze sodium 1-ethyl-4-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1-ethyl-4-fluorobenzene?
The IUPAC name of sodium 1-ethyl-4-fluorobenzene (CID 174390986) is sodium 1-ethyl-4-fluorobenzene.
What is the SMILES notation for sodium 1-ethyl-4-fluorobenzene?
The canonical SMILES for sodium 1-ethyl-4-fluorobenzene is [CH2-]Cc1ccc(F)cc1.[Na+].
What is the InChIKey of sodium 1-ethyl-4-fluorobenzene?
The InChIKey is ZKTDEECCMQAHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F.Na/c1-2-7-3-5-8(9)6-4-7;/h3-6H,1-2H2;/q-1;+1.
What are the key properties of sodium 1-ethyl-4-fluorobenzene?
sodium 1-ethyl-4-fluorobenzene has a molecular weight of 146.14 g/mol, XLogP of -0.79, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1-ethyl-4-fluorobenzene is sourced from PubChem (CID 174390986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).