C17H16FNO3 — CID 3632836
N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)propylidene]hydroxylamine (PubChem CID 3632836) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)propylidene]hydroxylamine.
| Compound Name | N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)propylidene]hydroxylamine |
|---|---|
| PubChem CID | 3632836 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(4-fluorophenyl)propylidene]hydroxylamine |
| SMILES | ON=C(CCc1ccc2c(c1)OCCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO3/c18-14-5-3-13(4-6-14)15(19-20)7-1-12-2-8-16-17(11-12)22-10-9-21-16/h2-6,8,11,20H,1,7,9-10H2 |
| InChIKey | JNTZZEDKFCYKBN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|