C11H14O4 — CID 163584472
3-(2,3-dihydro-1,4-benzodioxin-6-yl)propane-1,1-diol (PubChem CID 163584472) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)propane-1,1-diol.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)propane-1,1-diol |
|---|---|
| PubChem CID | 163584472 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)propane-1,1-diol |
| SMILES | OC(O)CCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H14O4/c12-11(13)4-2-8-1-3-9-10(7-8)15-6-5-14-9/h1,3,7,11-13H,2,4-6H2 |
| InChIKey | MWCFWNZTGDXNCZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|