C11H13NO2S — CID 82080478
3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanethioamide (PubChem CID 82080478) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanethioamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanethioamide |
|---|---|
| PubChem CID | 82080478 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)propanethioamide |
| SMILES | NC(=S)CCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H13NO2S/c12-11(15)4-2-8-1-3-9-10(7-8)14-6-5-13-9/h1,3,7H,2,4-6H2,(H2,12,15) |
| InChIKey | XEJYCCPRGHJBCJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|