C13H18O3S — CID 107752795
1-(3,4-dihydroxyphenyl)-2-(3-methylbutylsulfanyl)ethanone (PubChem CID 107752795) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(3-methylbutylsulfanyl)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(3-methylbutylsulfanyl)ethanone |
|---|---|
| PubChem CID | 107752795 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(3-methylbutylsulfanyl)ethanone |
| SMILES | CC(C)CCSCC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H18O3S/c1-9(2)5-6-17-8-13(16)10-3-4-11(14)12(15)7-10/h3-4,7,9,14-15H,5-6,8H2,1-2H3 |
| InChIKey | FYFFRLCFYIVAOZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|