C14H10Cl2O3 — CID 20539885
4-[2,2-dichloro-1-(4-hydroxyphenyl)ethenyl]benzene-1,2-diol (PubChem CID 20539885) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is 4-[2,2-dichloro-1-(4-hydroxyphenyl)ethenyl]benzene-1,2-diol.
| Compound Name | 4-[2,2-dichloro-1-(4-hydroxyphenyl)ethenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 20539885 |
| Molecular Formula | C14H10Cl2O3 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 4-[2,2-dichloro-1-(4-hydroxyphenyl)ethenyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C(=C(Cl)Cl)c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C14H10Cl2O3/c15-14(16)13(8-1-4-10(17)5-2-8)9-3-6-11(18)12(19)7-9/h1-7,17-19H |
| InChIKey | QDZLVDQMUGOCQA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|