About 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol
2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol (PubChem CID 2832089) has the molecular formula C14H12Cl2N2O2
and a molecular weight of 311.17 g/mol. Its IUPAC name is 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol.
Molecular Properties
| Compound Name | 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol |
| PubChem CID | 2832089 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol |
| SMILES | Nc1ccc(C(=C(Cl)Cl)c2ccc(N)c(O)c2)cc1O |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-14(16)13(7-1-3-9(17)11(19)5-7)8-2-4-10(18)12(20)6-8/h1-6,19-20H,17-18H2 |
| InChIKey | GTWSAPHPEOWLRP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol?
The IUPAC name of 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol (CID 2832089) is 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol.
What is the SMILES notation for 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol?
The canonical SMILES for 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol is Nc1ccc(C(=C(Cl)Cl)c2ccc(N)c(O)c2)cc1O.
What is the InChIKey of 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol?
The InChIKey is GTWSAPHPEOWLRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2N2O2/c15-14(16)13(7-1-3-9(17)11(19)5-7)8-2-4-10(18)12(20)6-8/h1-6,19-20H,17-18H2.
What are the key properties of 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol?
2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol has a molecular weight of 311.17 g/mol, XLogP of 3.46, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-[1-(4-amino-3-hydroxyphenyl)-2,2-dichloroethenyl]phenol is sourced from PubChem (CID 2832089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).