C10H12O4 — CID 3051378
1-(3,4-dihydroxyphenyl)-2-hydroxy-2-methylpropan-1-one (PubChem CID 3051378) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-hydroxy-2-methylpropan-1-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-hydroxy-2-methylpropan-1-one |
|---|---|
| PubChem CID | 3051378 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-hydroxy-2-methylpropan-1-one |
| SMILES | CC(C)(O)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C10H12O4/c1-10(2,14)9(13)6-3-4-7(11)8(12)5-6/h3-5,11-12,14H,1-2H3 |
| InChIKey | UYGBNZUGEZDSPT-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|