C12H16O3 — CID 68740835
2-hydroxy-1-[3-(hydroxymethyl)-4-methylphenyl]-2-methylpropan-1-one (PubChem CID 68740835) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-hydroxy-1-[3-(hydroxymethyl)-4-methylphenyl]-2-methylpropan-1-one.
| Compound Name | 2-hydroxy-1-[3-(hydroxymethyl)-4-methylphenyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 68740835 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-hydroxy-1-[3-(hydroxymethyl)-4-methylphenyl]-2-methylpropan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)(C)O)cc1CO |
| InChI | InChI=1S/C12H16O3/c1-8-4-5-9(6-10(8)7-13)11(14)12(2,3)15/h4-6,13,15H,7H2,1-3H3 |
| InChIKey | OOZMTEMYIIIYNJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |