C14H8BrF5O — CID 116629157
4-[bromo-[4-(trifluoromethoxy)phenyl]methyl]-1,2-difluorobenzene (PubChem CID 116629157) has the molecular formula C14H8BrF5O and a molecular weight of 367.11 g/mol. Its IUPAC name is 4-[bromo-[4-(trifluoromethoxy)phenyl]methyl]-1,2-difluorobenzene.
| Compound Name | 4-[bromo-[4-(trifluoromethoxy)phenyl]methyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 116629157 |
| Molecular Formula | C14H8BrF5O |
| Molecular Weight | 367.11 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 4-[bromo-[4-(trifluoromethoxy)phenyl]methyl]-1,2-difluorobenzene |
| SMILES | Fc1ccc(C(Br)c2ccc(OC(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C14H8BrF5O/c15-13(9-3-6-11(16)12(17)7-9)8-1-4-10(5-2-8)21-14(18,19)20/h1-7,13H |
| InChIKey | IXUONYDUGVRSKZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.11 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|