C14H8F7NO — CID 171249914
(R)-(2,3,5,6-tetrafluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 171249914) has the molecular formula C14H8F7NO and a molecular weight of 339.21 g/mol. Its IUPAC name is (R)-(2,3,5,6-tetrafluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine.
| Compound Name | (R)-(2,3,5,6-tetrafluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 171249914 |
| Molecular Formula | C14H8F7NO |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | (R)-(2,3,5,6-tetrafluorophenyl)-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | N[C@H](c1ccc(OC(F)(F)F)cc1)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C14H8F7NO/c15-8-5-9(16)12(18)10(11(8)17)13(22)6-1-3-7(4-2-6)23-14(19,20)21/h1-5,13H,22H2/t13-/m1/s1 |
| InChIKey | STXNGRXZUIMCSD-CYBMUJFWSA-N |
| XLogP | 4.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|