C14H10Cl2F3NO2 — CID 171244876
2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3,5-dichlorophenol (PubChem CID 171244876) has the molecular formula C14H10Cl2F3NO2 and a molecular weight of 352.14 g/mol. Its IUPAC name is 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3,5-dichlorophenol.
| Compound Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3,5-dichlorophenol |
|---|---|
| PubChem CID | 171244876 |
| Molecular Formula | C14H10Cl2F3NO2 |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-3,5-dichlorophenol |
| SMILES | N[C@@H](c1ccc(OC(F)(F)F)cc1)c1c(O)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2F3NO2/c15-8-5-10(16)12(11(21)6-8)13(20)7-1-3-9(4-2-7)22-14(17,18)19/h1-6,13,21H,20H2/t13-/m0/s1 |
| InChIKey | PCKCGQIZJGPMOI-ZDUSSCGKSA-N |
| XLogP | 4.65 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|