C16H16BrClF3NO2 — CID 171254288
2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-3,5-dimethylphenol;hydrochloride (PubChem CID 171254288) has the molecular formula C16H16BrClF3NO2 and a molecular weight of 426.66 g/mol. Its IUPAC name is 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-3,5-dimethylphenol;hydrochloride.
| Compound Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-3,5-dimethylphenol;hydrochloride |
|---|---|
| PubChem CID | 171254288 |
| Molecular Formula | C16H16BrClF3NO2 |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2-[(S)-amino-[4-(trifluoromethoxy)phenyl]methyl]-4-bromo-3,5-dimethylphenol;hydrochloride |
| SMILES | Cc1cc(O)c([C@@H](N)c2ccc(OC(F)(F)F)cc2)c(C)c1Br.Cl |
| InChI | InChI=1S/C16H15BrF3NO2.ClH/c1-8-7-12(22)13(9(2)14(8)17)15(21)10-3-5-11(6-4-10)23-16(18,19)20;/h3-7,15,22H,21H2,1-2H3;1H/t15-;/m0./s1 |
| InChIKey | JAXLIIITJHATKT-RSAXXLAASA-N |
| XLogP | 5.14 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|