C15H10Br2F2O2 — CID 63441557
6-bromo-7-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 63441557) has the molecular formula C15H10Br2F2O2 and a molecular weight of 420.05 g/mol. Its IUPAC name is 6-bromo-7-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 63441557 |
| Molecular Formula | C15H10Br2F2O2 |
| Molecular Weight | 420.05 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 6-bromo-7-[bromo-(3,4-difluorophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Fc1ccc(C(Br)c2cc3c(cc2Br)OCCO3)cc1F |
| InChI | InChI=1S/C15H10Br2F2O2/c16-10-7-14-13(20-3-4-21-14)6-9(10)15(17)8-1-2-11(18)12(19)5-8/h1-2,5-7,15H,3-4H2 |
| InChIKey | CGKHLJRADOKIPQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.05 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|