C8H7F2NO2 — CID 7019553
(2S)-2-azaniumyl-2-(3,4-difluorophenyl)acetate (PubChem CID 7019553) has the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. Its IUPAC name is (2S)-2-azaniumyl-2-(3,4-difluorophenyl)acetate.
| Compound Name | (2S)-2-azaniumyl-2-(3,4-difluorophenyl)acetate |
|---|---|
| PubChem CID | 7019553 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.14 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | (2S)-2-azaniumyl-2-(3,4-difluorophenyl)acetate |
| SMILES | [NH3+][C@H](C(=O)[O-])c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H7F2NO2/c9-5-2-1-4(3-6(5)10)7(11)8(12)13/h1-3,7H,11H2,(H,12,13)/t7-/m0/s1 |
| InChIKey | MPMRMNOQJFWMMA-ZETCQYMHSA-N |
| XLogP | -1.00 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.14 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |