C17H14F4O — CID 142067469
1,1-bis(3,4-difluorophenyl)pentan-3-one (PubChem CID 142067469) has the molecular formula C17H14F4O and a molecular weight of 310.29 g/mol. Its IUPAC name is 1,1-bis(3,4-difluorophenyl)pentan-3-one.
| Compound Name | 1,1-bis(3,4-difluorophenyl)pentan-3-one |
|---|---|
| PubChem CID | 142067469 |
| Molecular Formula | C17H14F4O |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1,1-bis(3,4-difluorophenyl)pentan-3-one |
| SMILES | CCC(=O)CC(c1ccc(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H14F4O/c1-2-12(22)9-13(10-3-5-14(18)16(20)7-10)11-4-6-15(19)17(21)8-11/h3-8,13H,2,9H2,1H3 |
| InChIKey | RBOXNWYHHZMSSA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |