2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid

C12H13F2NO3 — CID 63702483

IUPAC2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid
SMILESCC(C)N(C=O)C(C(=O)O)c1ccc(F)c(F)c1
InChIInChI=1S/C12H13F2NO3/c1-7(2)15(6-16)11(12(17)18)8-3-4-9(13)10(14)5-8/h3-7,11H,1-2H3,(H,17,18)
InChIKeyUJOWZPYLMQLLIK-UHFFFAOYSA-N
MW257.24 g/mol
LogP1.96
Rot. Bonds5

About 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid

2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid (PubChem CID 63702483) has the molecular formula C12H13F2NO3 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid.

Molecular Properties

Compound Name2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid
PubChem CID63702483
Molecular FormulaC12H13F2NO3
Molecular Weight257.24 g/mol
Exact Mass257.09
IUPAC Name2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid
SMILESCC(C)N(C=O)C(C(=O)O)c1ccc(F)c(F)c1
InChIInChI=1S/C12H13F2NO3/c1-7(2)15(6-16)11(12(17)18)8-3-4-9(13)10(14)5-8/h3-7,11H,1-2H3,(H,17,18)
InChIKeyUJOWZPYLMQLLIK-UHFFFAOYSA-N
XLogP1.96
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.24
LogP ≤ 51.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid?
The IUPAC name of 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid (CID 63702483) is 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid.
What is the SMILES notation for 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid?
The canonical SMILES for 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid is CC(C)N(C=O)C(C(=O)O)c1ccc(F)c(F)c1.
What is the InChIKey of 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid?
The InChIKey is UJOWZPYLMQLLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2NO3/c1-7(2)15(6-16)11(12(17)18)8-3-4-9(13)10(14)5-8/h3-7,11H,1-2H3,(H,17,18).
What are the key properties of 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid?
2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid has a molecular weight of 257.24 g/mol, XLogP of 1.96, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-2-[formyl(propan-2-yl)amino]acetic acid is sourced from PubChem (CID 63702483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).