2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid

C14H19F2NO2 — CID 84747042

IUPAC2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid
SMILESCCCCN(CC)C(C(=O)O)c1ccc(F)c(F)c1
InChIInChI=1S/C14H19F2NO2/c1-3-5-8-17(4-2)13(14(18)19)10-6-7-11(15)12(16)9-10/h6-7,9,13H,3-5,8H2,1-2H3,(H,18,19)
InChIKeyWGRWZCWXWRNHAY-UHFFFAOYSA-N
MW271.31 g/mol
LogP3.21
Rot. Bonds7

About 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid

2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid (PubChem CID 84747042) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid
PubChem CID84747042
Molecular FormulaC14H19F2NO2
Molecular Weight271.31 g/mol
Exact Mass271.14
IUPAC Name2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid
SMILESCCCCN(CC)C(C(=O)O)c1ccc(F)c(F)c1
InChIInChI=1S/C14H19F2NO2/c1-3-5-8-17(4-2)13(14(18)19)10-6-7-11(15)12(16)9-10/h6-7,9,13H,3-5,8H2,1-2H3,(H,18,19)
InChIKeyWGRWZCWXWRNHAY-UHFFFAOYSA-N
XLogP3.21
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.31
LogP ≤ 53.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid?
The IUPAC name of 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid (CID 84747042) is 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid is CCCCN(CC)C(C(=O)O)c1ccc(F)c(F)c1.
What is the InChIKey of 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid?
The InChIKey is WGRWZCWXWRNHAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO2/c1-3-5-8-17(4-2)13(14(18)19)10-6-7-11(15)12(16)9-10/h6-7,9,13H,3-5,8H2,1-2H3,(H,18,19).
What are the key properties of 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid?
2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid has a molecular weight of 271.31 g/mol, XLogP of 3.21, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid is sourced from PubChem (CID 84747042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).