C14H19F2NO2 — CID 84747042
2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid (PubChem CID 84747042) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid.
| Compound Name | 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid |
|---|---|
| PubChem CID | 84747042 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[butyl(ethyl)amino]-2-(3,4-difluorophenyl)acetic acid |
| SMILES | CCCCN(CC)C(C(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c1-3-5-8-17(4-2)13(14(18)19)10-6-7-11(15)12(16)9-10/h6-7,9,13H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | WGRWZCWXWRNHAY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |