C16H17F2NO3 — CID 174417631
(1S)-1-(3,4-difluorophenyl)ethanamine;2-hydroxy-2-phenylacetic acid (PubChem CID 174417631) has the molecular formula C16H17F2NO3 and a molecular weight of 309.31 g/mol. Its IUPAC name is (1S)-1-(3,4-difluorophenyl)ethanamine;2-hydroxy-2-phenylacetic acid.
| Compound Name | (1S)-1-(3,4-difluorophenyl)ethanamine;2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 174417631 |
| Molecular Formula | C16H17F2NO3 |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (1S)-1-(3,4-difluorophenyl)ethanamine;2-hydroxy-2-phenylacetic acid |
| SMILES | C[C@H](N)c1ccc(F)c(F)c1.O=C(O)C(O)c1ccccc1 |
| InChI | InChI=1S/C8H9F2N.C8H8O3/c1-5(11)6-2-3-7(9)8(10)4-6;9-7(8(10)11)6-4-2-1-3-5-6/h2-5H,11H2,1H3;1-5,7,9H,(H,10,11)/t5-;/m0./s1 |
| InChIKey | JQNQVAUXWCJPDG-JEDNCBNOSA-N |
| XLogP | 2.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |