C12H12ClF2NO3 — CID 68691787
2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid (PubChem CID 68691787) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid.
| Compound Name | 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid |
|---|---|
| PubChem CID | 68691787 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid |
| SMILES | O=C(CCCCl)NC(C(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H12ClF2NO3/c13-5-1-2-10(17)16-11(12(18)19)7-3-4-8(14)9(15)6-7/h3-4,6,11H,1-2,5H2,(H,16,17)(H,18,19) |
| InChIKey | CADFDFUCGATTAQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|