2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid

C12H12ClF2NO3 — CID 68691787

IUPAC2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid
SMILESO=C(CCCCl)NC(C(=O)O)c1ccc(F)c(F)c1
InChIInChI=1S/C12H12ClF2NO3/c13-5-1-2-10(17)16-11(12(18)19)7-3-4-8(14)9(15)6-7/h3-4,6,11H,1-2,5H2,(H,16,17)(H,18,19)
InChIKeyCADFDFUCGATTAQ-UHFFFAOYSA-N
MW291.68 g/mol
LogP2.23
Rot. Bonds6

About 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid

2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid (PubChem CID 68691787) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid
PubChem CID68691787
Molecular FormulaC12H12ClF2NO3
Molecular Weight291.68 g/mol
Exact Mass291.05
IUPAC Name2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid
SMILESO=C(CCCCl)NC(C(=O)O)c1ccc(F)c(F)c1
InChIInChI=1S/C12H12ClF2NO3/c13-5-1-2-10(17)16-11(12(18)19)7-3-4-8(14)9(15)6-7/h3-4,6,11H,1-2,5H2,(H,16,17)(H,18,19)
InChIKeyCADFDFUCGATTAQ-UHFFFAOYSA-N
XLogP2.23
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.68
LogP ≤ 52.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid?
The IUPAC name of 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid (CID 68691787) is 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid is O=C(CCCCl)NC(C(=O)O)c1ccc(F)c(F)c1.
What is the InChIKey of 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid?
The InChIKey is CADFDFUCGATTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClF2NO3/c13-5-1-2-10(17)16-11(12(18)19)7-3-4-8(14)9(15)6-7/h3-4,6,11H,1-2,5H2,(H,16,17)(H,18,19).
What are the key properties of 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid?
2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid has a molecular weight of 291.68 g/mol, XLogP of 2.23, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorobutanoylamino)-2-(3,4-difluorophenyl)acetic acid is sourced from PubChem (CID 68691787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).