C15H19ClFNO4 — CID 120688920
2-(4-chloro-3-fluorophenyl)-2-(4-propan-2-yloxybutanoylamino)acetic acid (PubChem CID 120688920) has the molecular formula C15H19ClFNO4 and a molecular weight of 331.77 g/mol. Its IUPAC name is 2-(4-chloro-3-fluorophenyl)-2-(4-propan-2-yloxybutanoylamino)acetic acid.
| Compound Name | 2-(4-chloro-3-fluorophenyl)-2-(4-propan-2-yloxybutanoylamino)acetic acid |
|---|---|
| PubChem CID | 120688920 |
| Molecular Formula | C15H19ClFNO4 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(4-chloro-3-fluorophenyl)-2-(4-propan-2-yloxybutanoylamino)acetic acid |
| SMILES | CC(C)OCCCC(=O)NC(C(=O)O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H19ClFNO4/c1-9(2)22-7-3-4-13(19)18-14(15(20)21)10-5-6-11(16)12(17)8-10/h5-6,8-9,14H,3-4,7H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | GTNORLVOKFGZRM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|