C16H21ClFNO4 — CID 120688583
3-(4-chloro-3-fluorophenyl)-3-(4-propan-2-yloxybutanoylamino)propanoic acid (PubChem CID 120688583) has the molecular formula C16H21ClFNO4 and a molecular weight of 345.80 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorophenyl)-3-(4-propan-2-yloxybutanoylamino)propanoic acid.
| Compound Name | 3-(4-chloro-3-fluorophenyl)-3-(4-propan-2-yloxybutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 120688583 |
| Molecular Formula | C16H21ClFNO4 |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-(4-chloro-3-fluorophenyl)-3-(4-propan-2-yloxybutanoylamino)propanoic acid |
| SMILES | CC(C)OCCCC(=O)NC(CC(=O)O)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H21ClFNO4/c1-10(2)23-7-3-4-15(20)19-14(9-16(21)22)11-5-6-12(17)13(18)8-11/h5-6,8,10,14H,3-4,7,9H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | RTUBEMIODBENGV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|