2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid

C13H15F2NO2 — CID 54894138

IUPAC2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid
SMILESO=C(O)C(NC1CCCC1)c1ccc(F)c(F)c1
InChIInChI=1S/C13H15F2NO2/c14-10-6-5-8(7-11(10)15)12(13(17)18)16-9-3-1-2-4-9/h5-7,9,12,16H,1-4H2,(H,17,18)
InChIKeyBKNKWPQVBCQGMT-UHFFFAOYSA-N
MW255.26 g/mol
LogP2.62
Rot. Bonds4

About 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid

2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid (PubChem CID 54894138) has the molecular formula C13H15F2NO2 and a molecular weight of 255.26 g/mol. Its IUPAC name is 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid
PubChem CID54894138
Molecular FormulaC13H15F2NO2
Molecular Weight255.26 g/mol
Exact Mass255.11
IUPAC Name2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid
SMILESO=C(O)C(NC1CCCC1)c1ccc(F)c(F)c1
InChIInChI=1S/C13H15F2NO2/c14-10-6-5-8(7-11(10)15)12(13(17)18)16-9-3-1-2-4-9/h5-7,9,12,16H,1-4H2,(H,17,18)
InChIKeyBKNKWPQVBCQGMT-UHFFFAOYSA-N
XLogP2.62
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.26
LogP ≤ 52.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid?
The IUPAC name of 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid (CID 54894138) is 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid.
What is the SMILES notation for 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid?
The canonical SMILES for 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid is O=C(O)C(NC1CCCC1)c1ccc(F)c(F)c1.
What is the InChIKey of 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid?
The InChIKey is BKNKWPQVBCQGMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c14-10-6-5-8(7-11(10)15)12(13(17)18)16-9-3-1-2-4-9/h5-7,9,12,16H,1-4H2,(H,17,18).
What are the key properties of 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid?
2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid has a molecular weight of 255.26 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopentylamino)-2-(3,4-difluorophenyl)acetic acid is sourced from PubChem (CID 54894138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).