C15H19Cl2NO2 — CID 60998445
2-(cycloheptylamino)-2-(2,6-dichlorophenyl)acetic acid (PubChem CID 60998445) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 2-(cycloheptylamino)-2-(2,6-dichlorophenyl)acetic acid.
| Compound Name | 2-(cycloheptylamino)-2-(2,6-dichlorophenyl)acetic acid |
|---|---|
| PubChem CID | 60998445 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(cycloheptylamino)-2-(2,6-dichlorophenyl)acetic acid |
| SMILES | O=C(O)C(NC1CCCCCC1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H19Cl2NO2/c16-11-8-5-9-12(17)13(11)14(15(19)20)18-10-6-3-1-2-4-7-10/h5,8-10,14,18H,1-4,6-7H2,(H,19,20) |
| InChIKey | VALGRSXPHDWQDV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |