C11H15Cl2NO2 — CID 82313271
3-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]propan-1-ol (PubChem CID 82313271) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 3-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]propan-1-ol.
| Compound Name | 3-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 82313271 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 3-[[2-(2,4-dichlorophenyl)-2-hydroxyethyl]amino]propan-1-ol |
| SMILES | OCCCNCC(O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c12-8-2-3-9(10(13)6-8)11(16)7-14-4-1-5-15/h2-3,6,11,14-16H,1,4-5,7H2 |
| InChIKey | FRZYIKNXLVQHJI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|