C11H11Cl2N2O+ — CID 51374227
(1R)-1-(2,4-dichlorophenyl)-2-(1H-imidazol-3-ium-3-yl)ethanol (PubChem CID 51374227) has the molecular formula C11H11Cl2N2O+ and a molecular weight of 258.13 g/mol. Its IUPAC name is (1R)-1-(2,4-dichlorophenyl)-2-(1H-imidazol-3-ium-3-yl)ethanol.
| Compound Name | (1R)-1-(2,4-dichlorophenyl)-2-(1H-imidazol-3-ium-3-yl)ethanol |
|---|---|
| PubChem CID | 51374227 |
| Molecular Formula | C11H11Cl2N2O+ |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | (1R)-1-(2,4-dichlorophenyl)-2-(1H-imidazol-3-ium-3-yl)ethanol |
| SMILES | O[C@@H](C[n+]1cc[nH]c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N2O/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15/h1-5,7,11,16H,6H2/p+1/t11-/m0/s1 |
| InChIKey | UKVLTPAGJIYSGN-NSHDSACASA-O |
| XLogP | 2.34 |
| TPSA | 39.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|