C11H12Cl2N2O — CID 86340265
(1S)-1-(2,4-dichlorophenyl)-2-(1,2-dihydroimidazol-3-yl)ethanol (PubChem CID 86340265) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is (1S)-1-(2,4-dichlorophenyl)-2-(1,2-dihydroimidazol-3-yl)ethanol.
| Compound Name | (1S)-1-(2,4-dichlorophenyl)-2-(1,2-dihydroimidazol-3-yl)ethanol |
|---|---|
| PubChem CID | 86340265 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | (1S)-1-(2,4-dichlorophenyl)-2-(1,2-dihydroimidazol-3-yl)ethanol |
| SMILES | O[C@H](CN1C=CNC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15/h1-5,11,14,16H,6-7H2/t11-/m1/s1 |
| InChIKey | DMDSLLRXQUHWDB-LLVKDONJSA-N |
| XLogP | 2.36 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |