C14H9ClF2O2 — CID 141352961
2-[2-chloro-4-(2,4-difluorophenoxy)phenyl]acetaldehyde (PubChem CID 141352961) has the molecular formula C14H9ClF2O2 and a molecular weight of 282.67 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,4-difluorophenoxy)phenyl]acetaldehyde.
| Compound Name | 2-[2-chloro-4-(2,4-difluorophenoxy)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 141352961 |
| Molecular Formula | C14H9ClF2O2 |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 2-[2-chloro-4-(2,4-difluorophenoxy)phenyl]acetaldehyde |
| SMILES | O=CCc1ccc(Oc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C14H9ClF2O2/c15-12-8-11(3-1-9(12)5-6-18)19-14-4-2-10(16)7-13(14)17/h1-4,6-8H,5H2 |
| InChIKey | ITFILTZPHBQIRP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|