C13H19Cl2NO — CID 70293179
1-[(2,4-dichlorophenyl)methoxy]-N,N-diethylethanamine (PubChem CID 70293179) has the molecular formula C13H19Cl2NO and a molecular weight of 276.21 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methoxy]-N,N-diethylethanamine.
| Compound Name | 1-[(2,4-dichlorophenyl)methoxy]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 70293179 |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)C(C)OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H19Cl2NO/c1-4-16(5-2)10(3)17-9-11-6-7-12(14)8-13(11)15/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | OGACBEOTAPAYFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|