C20H23Cl2NO3 — CID 67460438
1-(diethylamino)ethyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate (PubChem CID 67460438) has the molecular formula C20H23Cl2NO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is 1-(diethylamino)ethyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate.
| Compound Name | 1-(diethylamino)ethyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate |
|---|---|
| PubChem CID | 67460438 |
| Molecular Formula | C20H23Cl2NO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-(diethylamino)ethyl 2-[2-(2,4-dichlorophenoxy)phenyl]acetate |
| SMILES | CCN(CC)C(C)OC(=O)Cc1ccccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2NO3/c1-4-23(5-2)14(3)25-20(24)12-15-8-6-7-9-18(15)26-19-11-10-16(21)13-17(19)22/h6-11,13-14H,4-5,12H2,1-3H3 |
| InChIKey | ADTOCMPRRNLWPK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|