C14H19Cl2NO — CID 86320757
(3S)-3-[2-[(2,4-dichlorophenyl)methoxy]ethyl]piperidine (PubChem CID 86320757) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is (3S)-3-[2-[(2,4-dichlorophenyl)methoxy]ethyl]piperidine.
| Compound Name | (3S)-3-[2-[(2,4-dichlorophenyl)methoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 86320757 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (3S)-3-[2-[(2,4-dichlorophenyl)methoxy]ethyl]piperidine |
| SMILES | Clc1ccc(COCC[C@@H]2CCCNC2)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO/c15-13-4-3-12(14(16)8-13)10-18-7-5-11-2-1-6-17-9-11/h3-4,8,11,17H,1-2,5-7,9-10H2/t11-/m0/s1 |
| InChIKey | BKAPOHXRFFETFZ-NSHDSACASA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|