C12H18Cl2OSi — CID 70809258
[1-(2,4-dichlorophenyl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane (PubChem CID 70809258) has the molecular formula C12H18Cl2OSi and a molecular weight of 277.27 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane.
| Compound Name | [1-(2,4-dichlorophenyl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane |
|---|---|
| PubChem CID | 70809258 |
| Molecular Formula | C12H18Cl2OSi |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-methylpropan-2-yl]-hydroxy-dimethylsilane |
| SMILES | CC(C)(Cc1ccc(Cl)cc1Cl)[Si](C)(C)O |
| InChI | InChI=1S/C12H18Cl2OSi/c1-12(2,16(3,4)15)8-9-5-6-10(13)7-11(9)14/h5-7,15H,8H2,1-4H3 |
| InChIKey | FMJWIEIMGLACML-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|