C14H8Cl6 — CID 122575608
2,4-dichloro-1-[1,1-dichloro-2-(2,4-dichlorophenyl)ethyl]benzene (PubChem CID 122575608) has the molecular formula C14H8Cl6 and a molecular weight of 388.94 g/mol. Its IUPAC name is 2,4-dichloro-1-[1,1-dichloro-2-(2,4-dichlorophenyl)ethyl]benzene.
| Compound Name | 2,4-dichloro-1-[1,1-dichloro-2-(2,4-dichlorophenyl)ethyl]benzene |
|---|---|
| PubChem CID | 122575608 |
| Molecular Formula | C14H8Cl6 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 385.88 |
| IUPAC Name | 2,4-dichloro-1-[1,1-dichloro-2-(2,4-dichlorophenyl)ethyl]benzene |
| SMILES | Clc1ccc(CC(Cl)(Cl)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl6/c15-9-2-1-8(12(17)5-9)7-14(19,20)11-4-3-10(16)6-13(11)18/h1-6H,7H2 |
| InChIKey | JIVHJGAWVSSRIA-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|