C8H6Br2Cl2O2S — CID 66789276
1,1-dibromo-2-(2,4-dichlorophenyl)ethanesulfinic acid (PubChem CID 66789276) has the molecular formula C8H6Br2Cl2O2S and a molecular weight of 396.92 g/mol. Its IUPAC name is 1,1-dibromo-2-(2,4-dichlorophenyl)ethanesulfinic acid.
| Compound Name | 1,1-dibromo-2-(2,4-dichlorophenyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 66789276 |
| Molecular Formula | C8H6Br2Cl2O2S |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 393.78 |
| IUPAC Name | 1,1-dibromo-2-(2,4-dichlorophenyl)ethanesulfinic acid |
| SMILES | O=S(O)C(Br)(Br)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Br2Cl2O2S/c9-8(10,15(13)14)4-5-1-2-6(11)3-7(5)12/h1-3H,4H2,(H,13,14) |
| InChIKey | FNIQDGVFRJZTNC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|