C12H14Cl4 — CID 79447331
1-[2,2-bis(chloromethyl)butyl]-2,4-dichlorobenzene (PubChem CID 79447331) has the molecular formula C12H14Cl4 and a molecular weight of 300.06 g/mol. Its IUPAC name is 1-[2,2-bis(chloromethyl)butyl]-2,4-dichlorobenzene.
| Compound Name | 1-[2,2-bis(chloromethyl)butyl]-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 79447331 |
| Molecular Formula | C12H14Cl4 |
| Molecular Weight | 300.06 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 1-[2,2-bis(chloromethyl)butyl]-2,4-dichlorobenzene |
| SMILES | CCC(CCl)(CCl)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl4/c1-2-12(7-13,8-14)6-9-3-4-10(15)5-11(9)16/h3-5H,2,6-8H2,1H3 |
| InChIKey | NELSBUCFALXVLC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.06 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|