C16H13Cl5 — CID 79444471
2,4-dichloro-1-[3-chloro-2-(chloromethyl)-2-(2-chlorophenyl)propyl]benzene (PubChem CID 79444471) has the molecular formula C16H13Cl5 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2,4-dichloro-1-[3-chloro-2-(chloromethyl)-2-(2-chlorophenyl)propyl]benzene.
| Compound Name | 2,4-dichloro-1-[3-chloro-2-(chloromethyl)-2-(2-chlorophenyl)propyl]benzene |
|---|---|
| PubChem CID | 79444471 |
| Molecular Formula | C16H13Cl5 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 2,4-dichloro-1-[3-chloro-2-(chloromethyl)-2-(2-chlorophenyl)propyl]benzene |
| SMILES | ClCC(CCl)(Cc1ccc(Cl)cc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C16H13Cl5/c17-9-16(10-18,13-3-1-2-4-14(13)20)8-11-5-6-12(19)7-15(11)21/h1-7H,8-10H2 |
| InChIKey | XOSUIHHEJGOSMB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|