C16H13Br2ClF2 — CID 79446654
2-[3-bromo-2-(bromomethyl)-2-(2-chlorophenyl)propyl]-1,4-difluorobenzene (PubChem CID 79446654) has the molecular formula C16H13Br2ClF2 and a molecular weight of 438.54 g/mol. Its IUPAC name is 2-[3-bromo-2-(bromomethyl)-2-(2-chlorophenyl)propyl]-1,4-difluorobenzene.
| Compound Name | 2-[3-bromo-2-(bromomethyl)-2-(2-chlorophenyl)propyl]-1,4-difluorobenzene |
|---|---|
| PubChem CID | 79446654 |
| Molecular Formula | C16H13Br2ClF2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 435.90 |
| IUPAC Name | 2-[3-bromo-2-(bromomethyl)-2-(2-chlorophenyl)propyl]-1,4-difluorobenzene |
| SMILES | Fc1ccc(F)c(CC(CBr)(CBr)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H13Br2ClF2/c17-9-16(10-18,13-3-1-2-4-14(13)19)8-11-7-12(20)5-6-15(11)21/h1-7H,8-10H2 |
| InChIKey | JKPGEQVYXNENIH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|