C15H22Cl2 — CID 134535823
2,4-dichloro-1-(2,2-dimethylheptyl)benzene (PubChem CID 134535823) has the molecular formula C15H22Cl2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2,4-dichloro-1-(2,2-dimethylheptyl)benzene.
| Compound Name | 2,4-dichloro-1-(2,2-dimethylheptyl)benzene |
|---|---|
| PubChem CID | 134535823 |
| Molecular Formula | C15H22Cl2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2,4-dichloro-1-(2,2-dimethylheptyl)benzene |
| SMILES | CCCCCC(C)(C)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H22Cl2/c1-4-5-6-9-15(2,3)11-12-7-8-13(16)10-14(12)17/h7-8,10H,4-6,9,11H2,1-3H3 |
| InChIKey | FIFBKIXTOKUGCJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|