C13H12Cl2OS — CID 65145566
1-(2,4-dichlorophenyl)-2-thiophen-2-ylpropan-2-ol (PubChem CID 65145566) has the molecular formula C13H12Cl2OS and a molecular weight of 287.21 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-thiophen-2-ylpropan-2-ol.
| Compound Name | 1-(2,4-dichlorophenyl)-2-thiophen-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 65145566 |
| Molecular Formula | C13H12Cl2OS |
| Molecular Weight | 287.21 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-thiophen-2-ylpropan-2-ol |
| SMILES | CC(O)(Cc1ccc(Cl)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C13H12Cl2OS/c1-13(16,12-3-2-6-17-12)8-9-4-5-10(14)7-11(9)15/h2-7,16H,8H2,1H3 |
| InChIKey | KCWXORKTAYGCME-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.21 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |